CAS 1824069-88-6 appears in our catalog under these names: 2-(3,4-Difluorophenyl)cyclopropane-1-carboxamide, 98%, 2-(3,4-Difluorophenyl)cyclopropanecarboxamide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
2-(3,4-difluorophenyl)cyclopropane-1-carboxamide (CAS 1824069-88-6) is a chemical compound with the molecular formula C10H9F2NO and a molecular weight of 197.18 g/mol. IUPAC name: 2-(3,4-difluorophenyl)cyclopropane-1-carboxamide. InChIKey: PYEJQVYISBUGDU-UHFFFAOYSA-N.
| Molecular formula | C10H9F2NO |
|---|---|
| Molecular weight | 197.18 g/mol |
| IUPAC name | 2-(3,4-difluorophenyl)cyclopropane-1-carboxamide |
| InChIKey | PYEJQVYISBUGDU-UHFFFAOYSA-N |
| SMILES | C1C(C1C(=O)N)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)