Products 1824151-11-2

CAS 1824151-11-2 is the registry number for 2-Azabicyclo[2.2.1]heptane-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-azabicyclo[2.2.1]heptane-4-carboxylic acid (CAS 1824151-11-2) is a chemical compound with the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. IUPAC name: 2-azabicyclo[2.2.1]heptane-4-carboxylic acid. InChIKey: GSEADFBJEDRQEZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11NO2
Molecular weight141.17 g/mol
IUPAC name2-azabicyclo[2.2.1]heptane-4-carboxylic acid
InChIKeyGSEADFBJEDRQEZ-UHFFFAOYSA-N
SMILESC1CC2(CC1NC2)C(=O)O

Computed by PubChem (NCBI)