CAS 1824265-77-1 is the registry number for Vildagliptin Impurity 34. Offered by: Chemat Brand. Available pack sizes: on request.
7-aminoadamantane-1,3,5-triol (CAS 1824265-77-1) is a chemical compound with the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. IUPAC name: 7-aminoadamantane-1,3,5-triol. InChIKey: JOIXPDNLMHTMNU-UHFFFAOYSA-N.
| Molecular formula | C10H17NO3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 7-aminoadamantane-1,3,5-triol |
| InChIKey | JOIXPDNLMHTMNU-UHFFFAOYSA-N |
| SMILES | C1C2(CC3(CC1(CC(C2)(C3)O)O)O)N |
Computed by PubChem (NCBI)