CAS 1824284-09-4 is the registry number for 1,1-Dimethylethyl 6-fluoro-3,4-dihydro-3-oxo-1(2H)-quinoxalinecarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 6-fluoro-3-oxo-2,4-dihydroquinoxaline-1-carboxylate (CAS 1824284-09-4) is a chemical compound with the molecular formula C13H15FN2O3 and a molecular weight of 266.27 g/mol. IUPAC name: tert-butyl 6-fluoro-3-oxo-2,4-dihydroquinoxaline-1-carboxylate. InChIKey: BDYFMEQYSGTAQS-UHFFFAOYSA-N.
| Molecular formula | C13H15FN2O3 |
|---|---|
| Molecular weight | 266.27 g/mol |
| IUPAC name | tert-butyl 6-fluoro-3-oxo-2,4-dihydroquinoxaline-1-carboxylate |
| InChIKey | BDYFMEQYSGTAQS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)NC2=C1C=CC(=C2)F |
Computed by PubChem (NCBI)