CAS 2227589-22-0 appears in our catalog under these names: Apalutamide Impurity 37, 1-((3-Fluoro-4-(methylcarbamoyl)phenyl)amino)cyclobutane-1-carboxylic acid, 1-((3-Fluoro-4-(methylcarbamoyl)phenyl)amino)cyclobutane-1-carboxylic acid, 98%, 98%, Apalutamide Impurity 13. Offered by: Chemat Brand, TRC, Chemat. Available pack sizes: on request, 500mg, 1g, 5g.
1-[3-fluoro-4-(methylcarbamoyl)anilino]cyclobutane-1-carboxylic acid (CAS 2227589-22-0) is a chemical compound with the molecular formula C13H15FN2O3 and a molecular weight of 266.27 g/mol. IUPAC name: 1-[3-fluoro-4-(methylcarbamoyl)anilino]cyclobutane-1-carboxylic acid. InChIKey: FGOGELABKVPEAL-UHFFFAOYSA-N.
| Molecular formula | C13H15FN2O3 |
|---|---|
| Molecular weight | 266.27 g/mol |
| IUPAC name | 1-[3-fluoro-4-(methylcarbamoyl)anilino]cyclobutane-1-carboxylic acid |
| InChIKey | FGOGELABKVPEAL-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=C(C=C(C=C1)NC2(CCC2)C(=O)O)F |
Computed by PubChem (NCBI)