CAS 1824360-14-6 is the registry number for 5-Ethynylindolin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-ethynyl-1,3-dihydroindol-2-one (CAS 1824360-14-6) is a chemical compound with the molecular formula C10H7NO and a molecular weight of 157.17 g/mol. IUPAC name: 5-ethynyl-1,3-dihydroindol-2-one. InChIKey: YQPXEKOGNZIYEY-UHFFFAOYSA-N.
| Molecular formula | C10H7NO |
|---|---|
| Molecular weight | 157.17 g/mol |
| IUPAC name | 5-ethynyl-1,3-dihydroindol-2-one |
| InChIKey | YQPXEKOGNZIYEY-UHFFFAOYSA-N |
| SMILES | C#CC1=CC2=C(C=C1)NC(=O)C2 |
Computed by PubChem (NCBI)