CAS 1824377-25-4 appears in our catalog under these names: tert-Butyl 2-formyl-4,4-dimethylpyrrolidine-1-carboxylate, 95%, tert-Butyl 2-formyl-4,4-dimethylpyrrolidine-1-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Tert-butyl 2-formyl-4,4-dimethylpyrrolidine-1-carboxylate (CAS 1824377-25-4) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: tert-butyl 2-formyl-4,4-dimethylpyrrolidine-1-carboxylate. InChIKey: YAOIGHGUUSCYRF-UHFFFAOYSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | tert-butyl 2-formyl-4,4-dimethylpyrrolidine-1-carboxylate |
| InChIKey | YAOIGHGUUSCYRF-UHFFFAOYSA-N |
| SMILES | CC1(CC(N(C1)C(=O)OC(C)(C)C)C=O)C |
Computed by PubChem (NCBI)