Products 1824498-96-5
CAS 1824498-96-5 appears in our catalog under these names: 1-Amino-3-(trifluoromethyl)cyclobutane-1-carboxylic acid, 95%, 1-amino-3-(trifluoromethyl)cyclobutane-1-carboxylic acid, 97%, 1–Amino–3–(trifluoromethyl)cyclobutane–1–carboxylic acid, 1-amino-3-(trifluoromethyl)cyclobutane-1-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 500mg.
1-amino-3-(trifluoromethyl)cyclobutane-1-carboxylic acid (CAS 1824498-96-5) is a chemical compound with the molecular formula C6H8F3NO2 and a molecular weight of 183.13 g/mol. IUPAC name: 1-amino-3-(trifluoromethyl)cyclobutane-1-carboxylic acid. InChIKey: LYMKAFXTEMWUOU-UHFFFAOYSA-N.
| Molecular formula | C6H8F3NO2 |
|---|---|
| Molecular weight | 183.13 g/mol |
| IUPAC name | 1-amino-3-(trifluoromethyl)cyclobutane-1-carboxylic acid |
| InChIKey | LYMKAFXTEMWUOU-UHFFFAOYSA-N |
| SMILES | C1C(CC1(C(=O)O)N)C(F)(F)F |
Computed by PubChem (NCBI)