CAS 18245-29-9 is the registry number for 2–(BICYCLOHEPTYL)TRICHLOROSILANE. Offered by: GLPBio. Available pack sizes: 10g, 50g.
2-bicyclo[2.2.1]heptanyl(trichloro)silane (CAS 18245-29-9) is a chemical compound with the molecular formula C7H11Cl3Si and a molecular weight of 229.6 g/mol. IUPAC name: 2-bicyclo[2.2.1]heptanyl(trichloro)silane. InChIKey: FMUGJGVGEWHETE-UHFFFAOYSA-N.
| Molecular formula | C7H11Cl3Si |
|---|---|
| Molecular weight | 229.6 g/mol |
| IUPAC name | 2-bicyclo[2.2.1]heptanyl(trichloro)silane |
| InChIKey | FMUGJGVGEWHETE-UHFFFAOYSA-N |
| SMILES | C1CC2CC1CC2[Si](Cl)(Cl)Cl |
Computed by PubChem (NCBI)