CAS 18246-04-3 is the registry number for Dimethyl(4-chlorophenyl)silanol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.
(4-chlorophenyl)-hydroxy-dimethylsilane (CAS 18246-04-3) is a chemical compound with the molecular formula C8H11ClOSi and a molecular weight of 186.71 g/mol. IUPAC name: (4-chlorophenyl)-hydroxy-dimethylsilane. InChIKey: KOCSUCCLZUOSOV-UHFFFAOYSA-N.
| Molecular formula | C8H11ClOSi |
|---|---|
| Molecular weight | 186.71 g/mol |
| IUPAC name | (4-chlorophenyl)-hydroxy-dimethylsilane |
| InChIKey | KOCSUCCLZUOSOV-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C1=CC=C(C=C1)Cl)O |
Computed by PubChem (NCBI)