CAS 1824637-41-3 appears in our catalog under these names: VY–3–135, VY-3-135, 99.94%, VY-3-135/ 99.25% (existing batch purity), (R)-1-Ethyl-2-(hydroxydiphenylmethyl)-N-(2-hydroxypropyl)-1H-benzo[d]imidazole-6-carboxamide, 99%, 99%. Offered by: GLPBio, MedChemExpress, TargetMol, Chemat. Available pack sizes: 10mg, 25mg, 5mg, 100 mg, 1 mg, 25 mg, 10mM/1mL, 10 mg.
3-ethyl-2-[hydroxy(diphenyl)methyl]-N-[(2R)-2-hydroxypropyl]benzimidazole-5-carboxamide (CAS 1824637-41-3) is a chemical compound with the molecular formula C26H27N3O3 and a molecular weight of 429.5 g/mol. IUPAC name: 3-ethyl-2-[hydroxy(diphenyl)methyl]-N-[(2R)-2-hydroxypropyl]benzimidazole-5-carboxamide. InChIKey: KTPYOTKTDCLZHR-GOSISDBHSA-N.
| Molecular formula | C26H27N3O3 |
|---|---|
| Molecular weight | 429.5 g/mol |
| IUPAC name | 3-ethyl-2-[hydroxy(diphenyl)methyl]-N-[(2R)-2-hydroxypropyl]benzimidazole-5-carboxamide |
| InChIKey | KTPYOTKTDCLZHR-GOSISDBHSA-N |
| SMILES | CCN1C2=C(C=CC(=C2)C(=O)NC[C@@H](C)O)N=C1C(C3=CC=CC=C3)(C4=CC=CC=C4)O |
Computed by PubChem (NCBI)