CAS 1824663-62-8 is the registry number for 7-Bromo-3-(trifluoromethyl)benzofuran, 98%. Offered by: AmBeed. Available pack sizes: 100mg, 250mg.
7-bromo-3-(trifluoromethyl)-1-benzofuran (CAS 1824663-62-8) is a chemical compound with the molecular formula C9H4BrF3O and a molecular weight of 265.03 g/mol. IUPAC name: 7-bromo-3-(trifluoromethyl)-1-benzofuran. InChIKey: JYUNBZJLOKESDC-UHFFFAOYSA-N.
| Molecular formula | C9H4BrF3O |
|---|---|
| Molecular weight | 265.03 g/mol |
| IUPAC name | 7-bromo-3-(trifluoromethyl)-1-benzofuran |
| InChIKey | JYUNBZJLOKESDC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)OC=C2C(F)(F)F |
Computed by PubChem (NCBI)