CAS 1824793-33-0 appears in our catalog under these names: 2-Hydroxy-3,5-diiodomethylnitrostyrene, 95%, 2-Hydroxy-3,5-diiodomethylnitrostyrene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg.
2,4-bis(iodomethyl)-6-[(E)-2-nitroethenyl]phenol (CAS 1824793-33-0) is a chemical compound with the molecular formula C10H9I2NO3 and a molecular weight of 444.99 g/mol. IUPAC name: 2,4-bis(iodomethyl)-6-[(E)-2-nitroethenyl]phenol. InChIKey: PVLZYRVDFOINOU-OWOJBTEDSA-N.
| Molecular formula | C10H9I2NO3 |
|---|---|
| Molecular weight | 444.99 g/mol |
| IUPAC name | 2,4-bis(iodomethyl)-6-[(E)-2-nitroethenyl]phenol |
| InChIKey | PVLZYRVDFOINOU-OWOJBTEDSA-N |
| SMILES | C1=C(C=C(C(=C1CI)O)/C=C/[N+](=O)[O-])CI |
Computed by PubChem (NCBI)