CAS 1824976-81-9 is the registry number for N-(2,5-DICHLOROBENZOYL)GLYCYL-L-LEUCINE. Offered by: Sigma-Aldrich. Available pack sizes: 500MG.
(2S)-2-[[2-[(2,5-dichlorobenzoyl)amino]acetyl]amino]-4-methylpentanoic acid (CAS 1824976-81-9) is a chemical compound with the molecular formula C15H18Cl2N2O4 and a molecular weight of 361.2 g/mol. IUPAC name: (2S)-2-[[2-[(2,5-dichlorobenzoyl)amino]acetyl]amino]-4-methylpentanoic acid. InChIKey: DNIFDGIEBFRALC-LBPRGKRZSA-N.
| Molecular formula | C15H18Cl2N2O4 |
|---|---|
| Molecular weight | 361.2 g/mol |
| IUPAC name | (2S)-2-[[2-[(2,5-dichlorobenzoyl)amino]acetyl]amino]-4-methylpentanoic acid |
| InChIKey | DNIFDGIEBFRALC-LBPRGKRZSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)CNC(=O)C1=C(C=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)