Products 182504-18-3
CAS 182504-18-3 is the registry number for MSD-D. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4-methoxyphenyl)-5-methyl-6-(4-methylphenyl)sulfanyl-3-oxopyridazine-4-carbonitrile (CAS 182504-18-3) is a chemical compound with the molecular formula C20H17N3O2S and a molecular weight of 363.4 g/mol. IUPAC name: 2-(4-methoxyphenyl)-5-methyl-6-(4-methylphenyl)sulfanyl-3-oxopyridazine-4-carbonitrile. InChIKey: YMRVCZZVGOWQDN-UHFFFAOYSA-N.
| Molecular formula | C20H17N3O2S |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-5-methyl-6-(4-methylphenyl)sulfanyl-3-oxopyridazine-4-carbonitrile |
| InChIKey | YMRVCZZVGOWQDN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)SC2=NN(C(=O)C(=C2C)C#N)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)