Products 1825355-55-2
CAS 1825355-55-2 appears in our catalog under these names: Ribocil B (Ribocil S enantiomer), Ribocil B. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 2mg, 10mg, 100mg, 5mg, 50mg, 25mg, Get quote.
2-[(3S)-1-[[2-(methylamino)pyrimidin-5-yl]methyl]piperidin-3-yl]-4-thiophen-2-yl-1H-pyrimidin-6-one (CAS 1825355-55-2) is a chemical compound with the molecular formula C19H22N6OS and a molecular weight of 382.5 g/mol. IUPAC name: 2-[(3S)-1-[[2-(methylamino)pyrimidin-5-yl]methyl]piperidin-3-yl]-4-thiophen-2-yl-1H-pyrimidin-6-one. InChIKey: ZSXCVAIJFUEGJR-AWEZNQCLSA-N.
| Molecular formula | C19H22N6OS |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | 2-[(3S)-1-[[2-(methylamino)pyrimidin-5-yl]methyl]piperidin-3-yl]-4-thiophen-2-yl-1H-pyrimidin-6-one |
| InChIKey | ZSXCVAIJFUEGJR-AWEZNQCLSA-N |
| SMILES | CNC1=NC=C(C=N1)CN2CCC[C@@H](C2)C3=NC(=CC(=O)N3)C4=CC=CS4 |
Computed by PubChem (NCBI)