CAS 18254-13-2 appears in our catalog under these names: 2,4,6-Tris(1-phenylethyl)phenol, 95%, 2,4,6-Tris(1-phenylethyl)-phenol. Offered by: Combi-blocks, HPC Standards. Available pack sizes: 1g, 100mg, 250mg, 1x10mg.
2,4,6-tris(1-phenylethyl)phenol (CAS 18254-13-2) is a chemical compound with the molecular formula C30H30O and a molecular weight of 406.6 g/mol. IUPAC name: 2,4,6-tris(1-phenylethyl)phenol. InChIKey: BYLSIPUARIZAHZ-UHFFFAOYSA-N.
| Molecular formula | C30H30O |
|---|---|
| Molecular weight | 406.6 g/mol |
| IUPAC name | 2,4,6-tris(1-phenylethyl)phenol |
| InChIKey | BYLSIPUARIZAHZ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)C2=CC(=C(C(=C2)C(C)C3=CC=CC=C3)O)C(C)C4=CC=CC=C4 |
Computed by PubChem (NCBI)