CAS 1826116-38-4 appears in our catalog under these names: SLMP53-2, 98%, SLMP53-2, 99.96%. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 5 mg, 100 mg, 10 mg, 50 mg, 10mM/1mL, 25 mg.
(3S,9bR)-3-[(1-methylindol-3-yl)methyl]-9b-phenyl-2,3-dihydro-[1,3]oxazolo[2,3-a]isoindol-5-one (CAS 1826116-38-4) is a chemical compound with the molecular formula C26H22N2O2 and a molecular weight of 394.5 g/mol. IUPAC name: (3S,9bR)-3-[(1-methylindol-3-yl)methyl]-9b-phenyl-2,3-dihydro-[1,3]oxazolo[2,3-a]isoindol-5-one. InChIKey: PEHYINMYYPHEER-RXFWQSSRSA-N.
| Molecular formula | C26H22N2O2 |
|---|---|
| Molecular weight | 394.5 g/mol |
| IUPAC name | (3S,9bR)-3-[(1-methylindol-3-yl)methyl]-9b-phenyl-2,3-dihydro-[1,3]oxazolo[2,3-a]isoindol-5-one |
| InChIKey | PEHYINMYYPHEER-RXFWQSSRSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)C[C@H]3CO[C@]4(N3C(=O)C5=CC=CC=C54)C6=CC=CC=C6 |
Computed by PubChem (NCBI)