CAS 18274-81-2 appears in our catalog under these names: Desmethylanethol trithione/ 98.23% (existing batch purity), ADT–OH, ADT-OH 97%, 5-(4-Hydroxyphenyl)-3H-1,2-dithiole-3-thione, 97%, 97%, ADT-OH, 98.55%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 250mg, 1g.
5-(4-hydroxyphenyl)dithiole-3-thione (CAS 18274-81-2) is a chemical compound with the molecular formula C9H6OS3 and a molecular weight of 226.3 g/mol. IUPAC name: 5-(4-hydroxyphenyl)dithiole-3-thione. InChIKey: IWBBKLMHAILHAR-UHFFFAOYSA-N.
| Molecular formula | C9H6OS3 |
|---|---|
| Molecular weight | 226.3 g/mol |
| IUPAC name | 5-(4-hydroxyphenyl)dithiole-3-thione |
| InChIKey | IWBBKLMHAILHAR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=S)SS2)O |
Computed by PubChem (NCBI)