CAS 1827680-56-7 is the registry number for Ethyl (R)-1,4,5,6-tetrahydropyrrolo[3,4-c]pyrazole-4-carboxylate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 1,4,5,6-tetrahydropyrrolo[3,4-d]pyrazole-4-carboxylate;hydrochloride (CAS 1827680-56-7) is a chemical compound with the molecular formula C8H12ClN3O2 and a molecular weight of 217.65 g/mol. IUPAC name: ethyl 1,4,5,6-tetrahydropyrrolo[3,4-d]pyrazole-4-carboxylate;hydrochloride. InChIKey: LDOODJIGASHNSZ-UHFFFAOYSA-N.
| Molecular formula | C8H12ClN3O2 |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | ethyl 1,4,5,6-tetrahydropyrrolo[3,4-d]pyrazole-4-carboxylate;hydrochloride |
| InChIKey | LDOODJIGASHNSZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C2=C(CN1)NN=C2.Cl |
Computed by PubChem (NCBI)