CAS 182801-94-1 appears in our catalog under these names: tert-Butyl(cyclopent-3-en-1-yloxy)diphenylsilane, 95%, tert–butyl(cyclopent–3–en–1–yloxy)diphenylsilane. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Tert-butyl-cyclopent-3-en-1-yloxy-diphenylsilane (CAS 182801-94-1) is a chemical compound with the molecular formula C21H26OSi and a molecular weight of 322.5 g/mol. IUPAC name: tert-butyl-cyclopent-3-en-1-yloxy-diphenylsilane. InChIKey: GCODZQWZNXYLIA-UHFFFAOYSA-N.
| Molecular formula | C21H26OSi |
|---|---|
| Molecular weight | 322.5 g/mol |
| IUPAC name | tert-butyl-cyclopent-3-en-1-yloxy-diphenylsilane |
| InChIKey | GCODZQWZNXYLIA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OC3CC=CC3 |
Computed by PubChem (NCBI)