CAS 182959-33-7 appears in our catalog under these names: YM-53601, YM–53601, (E)-2-(2-Fluoro-2-(quinuclidin-3-ylidene)ethoxy)-9H-carbazole hydrochloride, 99%, 99%, YM-53601, 99.37%, YM-53601 (Standard). Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 1mg, 5mg, 10mM (in 1ml dmso), 0,1g, 0,5g, 1g.
2-[(2E)-2-(1-azabicyclo[2.2.2]octan-3-ylidene)-2-fluoroethoxy]-9H-carbazole;hydrochloride (CAS 182959-33-7) is a chemical compound with the molecular formula C21H22ClFN2O and a molecular weight of 372.9 g/mol. IUPAC name: 2-[(2E)-2-(1-azabicyclo[2.2.2]octan-3-ylidene)-2-fluoroethoxy]-9H-carbazole;hydrochloride. InChIKey: JWXYVHMBPISIJQ-TVWXOORISA-N.
| Molecular formula | C21H22ClFN2O |
|---|---|
| Molecular weight | 372.9 g/mol |
| IUPAC name | 2-[(2E)-2-(1-azabicyclo[2.2.2]octan-3-ylidene)-2-fluoroethoxy]-9H-carbazole;hydrochloride |
| InChIKey | JWXYVHMBPISIJQ-TVWXOORISA-N |
| SMILES | C1CN2CCC1/C(=C(/COC3=CC4=C(C=C3)C5=CC=CC=C5N4)\F)/C2.Cl |
Computed by PubChem (NCBI)