CAS 18300-04-4 is the registry number for trans-Bromdane. Offered by: TRC. Available pack sizes: 50mg.
3,4-dibromo-1,7,8,9,10,10-hexachlorotricyclo[5.2.1.02,6]dec-8-ene (CAS 18300-04-4) is a chemical compound with the molecular formula C10H6Br2Cl6 and a molecular weight of 498.7 g/mol. IUPAC name: 3,4-dibromo-1,7,8,9,10,10-hexachlorotricyclo[5.2.1.02,6]dec-8-ene. InChIKey: RVVRZNVGDRBUJH-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2Cl6 |
|---|---|
| Molecular weight | 498.7 g/mol |
| IUPAC name | 3,4-dibromo-1,7,8,9,10,10-hexachlorotricyclo[5.2.1.02,6]dec-8-ene |
| InChIKey | RVVRZNVGDRBUJH-UHFFFAOYSA-N |
| SMILES | C1C2C(C(C1Br)Br)C3(C(=C(C2(C3(Cl)Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)