CAS 183008-14-2 is the registry number for 4-(Thiophen-2-yl)-1,2,3,4-tetrahydroisoquinoline hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-thiophen-2-yl-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 183008-14-2) is a chemical compound with the molecular formula C13H14ClNS and a molecular weight of 251.78 g/mol. IUPAC name: 4-thiophen-2-yl-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: GORNESXSCDJFIF-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNS |
|---|---|
| Molecular weight | 251.78 g/mol |
| IUPAC name | 4-thiophen-2-yl-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | GORNESXSCDJFIF-UHFFFAOYSA-N |
| SMILES | C1C(C2=CC=CC=C2CN1)C3=CC=CS3.Cl |
Computed by PubChem (NCBI)