CAS 183016-21-9 appears in our catalog under these names: Decitabine Impurity 44, Decitabine Impurity 5, 3-Toluoyl Decitabine, >95% (HPLC), 3-O-Toluoyl decitabine. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
[(2R,3S,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] 4-methylbenzoate (CAS 183016-21-9) is a chemical compound with the molecular formula C16H18N4O5 and a molecular weight of 346.34 g/mol. IUPAC name: [(2R,3S,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] 4-methylbenzoate. InChIKey: SSLXSDIEMBZMAB-YNEHKIRRSA-N.
| Molecular formula | C16H18N4O5 |
|---|---|
| Molecular weight | 346.34 g/mol |
| IUPAC name | [(2R,3S,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] 4-methylbenzoate |
| InChIKey | SSLXSDIEMBZMAB-YNEHKIRRSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)O[C@H]2C[C@@H](O[C@@H]2CO)N3C=NC(=NC3=O)N |
Computed by PubChem (NCBI)