Products 1830484-40-6

CAS 1830484-40-6 is the registry number for LAG-3 biner 1, 97.08%. Offered by: MedChemExpress. Available pack sizes: 5 mg.

Structural formula: {0} (CAS {1})

3-[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]carbamoyl]benzoic acid (CAS 1830484-40-6) is a chemical compound with the molecular formula C19H18F3N3O3 and a molecular weight of 393.4 g/mol. IUPAC name: 3-[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]carbamoyl]benzoic acid. InChIKey: ISAQGRHIPOXGLC-UHFFFAOYSA-N.

Identity
Molecular formulaC19H18F3N3O3
Molecular weight393.4 g/mol
IUPAC name3-[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]carbamoyl]benzoic acid
InChIKeyISAQGRHIPOXGLC-UHFFFAOYSA-N
SMILESC1CN(CCC1NC(=O)C2=CC(=CC=C2)C(=O)O)C3=NC=C(C=C3)C(F)(F)F

Computed by PubChem (NCBI)