CAS 18306-29-1 appears in our catalog under these names: Bis(trimethylsilyl) sulfate, 98%, Bis(trimethylsilyl) Sulfate, Bis(trimethylsilyl) Sulfate, >98.0%(T), Bis(trimethylsilyl) sulfate 90%, Bis(trimethylsilyl) sulfate, 95%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 5g, 25g, 1g, 100g.
Bis(trimethylsilyl) sulfate (CAS 18306-29-1) is a chemical compound with the molecular formula C6H18O4SSi2 and a molecular weight of 242.44 g/mol. IUPAC name: bis(trimethylsilyl) sulfate. InChIKey: KRUQDZRWZXUUAD-UHFFFAOYSA-N.
| Molecular formula | C6H18O4SSi2 |
|---|---|
| Molecular weight | 242.44 g/mol |
| IUPAC name | bis(trimethylsilyl) sulfate |
| InChIKey | KRUQDZRWZXUUAD-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OS(=O)(=O)O[Si](C)(C)C |
Computed by PubChem (NCBI)