CAS 1831010-87-7 is the registry number for 1-((3,4-Dimethylphenyl)sulfonyl)piperidin-4-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3,4-dimethylphenyl)sulfonylpiperidin-4-amine;hydrochloride (CAS 1831010-87-7) is a chemical compound with the molecular formula C13H21ClN2O2S and a molecular weight of 304.84 g/mol. IUPAC name: 1-(3,4-dimethylphenyl)sulfonylpiperidin-4-amine;hydrochloride. InChIKey: NQVNOVCXQGSICS-UHFFFAOYSA-N.
| Molecular formula | C13H21ClN2O2S |
|---|---|
| Molecular weight | 304.84 g/mol |
| IUPAC name | 1-(3,4-dimethylphenyl)sulfonylpiperidin-4-amine;hydrochloride |
| InChIKey | NQVNOVCXQGSICS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)N2CCC(CC2)N)C.Cl |
Computed by PubChem (NCBI)