CAS 183140-97-8 is the registry number for GMC 1–169. Offered by: GLPBio. Available pack sizes: 10mg.
[6-(4-methylpiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepin-8-yl] trifluoromethanesulfonate (CAS 183140-97-8) is a chemical compound with the molecular formula C19H19F3N4O3S and a molecular weight of 440.4 g/mol. IUPAC name: [6-(4-methylpiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepin-8-yl] trifluoromethanesulfonate. InChIKey: XKXPMSXRABANAG-UHFFFAOYSA-N.
| Molecular formula | C19H19F3N4O3S |
|---|---|
| Molecular weight | 440.4 g/mol |
| IUPAC name | [6-(4-methylpiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepin-8-yl] trifluoromethanesulfonate |
| InChIKey | XKXPMSXRABANAG-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=NC3=CC=CC=C3NC4=C2C=C(C=C4)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)