CAS 183162-69-8 appears in our catalog under these names: Sodium 2-hydroxy-2-(pyridin-2-yl)propanoate, 95%, Sodium 2-hydroxy-2-(pyridin-2-yl)propanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 0,5g, 50mg.
Sodium 2-hydroxy-2-pyridin-2-ylpropanoate (CAS 183162-69-8) is a chemical compound with the molecular formula C8H8NNaO3 and a molecular weight of 189.14 g/mol. IUPAC name: sodium 2-hydroxy-2-pyridin-2-ylpropanoate. InChIKey: AIMGDCXQZIWZGT-UHFFFAOYSA-M.
| Molecular formula | C8H8NNaO3 |
|---|---|
| Molecular weight | 189.14 g/mol |
| IUPAC name | sodium 2-hydroxy-2-pyridin-2-ylpropanoate |
| InChIKey | AIMGDCXQZIWZGT-UHFFFAOYSA-M |
| SMILES | CC(C1=CC=CC=N1)(C(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)