CAS 183193-59-1 appears in our catalog under these names: 2-NP-AMOZ, >95% (HPLC), 2-NP-AMOZ, 2–NP–AMOZ, 2-NP-AMOZ, Vetranal, 2-NP-AMOZ, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Sigma-Aldrich, HPC Standards. Available pack sizes: 100mg, 10mg, 1x1ml, 1x10mg, Get quote, 10 mg.
5-(morpholin-4-ylmethyl)-3-[(E)-(2-nitrophenyl)methylideneamino]-1,3-oxazolidin-2-one (CAS 183193-59-1) is a chemical compound with the molecular formula C15H18N4O5 and a molecular weight of 334.33 g/mol. IUPAC name: 5-(morpholin-4-ylmethyl)-3-[(E)-(2-nitrophenyl)methylideneamino]-1,3-oxazolidin-2-one. InChIKey: PCYAMVONOKWOLP-CXUHLZMHSA-N.
| Molecular formula | C15H18N4O5 |
|---|---|
| Molecular weight | 334.33 g/mol |
| IUPAC name | 5-(morpholin-4-ylmethyl)-3-[(E)-(2-nitrophenyl)methylideneamino]-1,3-oxazolidin-2-one |
| InChIKey | PCYAMVONOKWOLP-CXUHLZMHSA-N |
| SMILES | C1COCCN1CC2CN(C(=O)O2)/N=C/C3=CC=CC=C3[N+](=O)[O-] |
Computed by PubChem (NCBI)