Products 183210-63-1
CAS 183210-63-1 appears in our catalog under these names: 1,7-Dihydroxy-2,3-methylenedioxyxanthone, 1,7-Dihydroxy-2,3-methylenedioxyxanthone, ≥95%. Offered by: MedChemExpress, Chemat. Available pack sizes: Get quote, 5mg.
8,11-dihydroxy-[1,3]dioxolo[4,5-b]xanthen-10-one (CAS 183210-63-1) is a chemical compound with the molecular formula C14H8O6 and a molecular weight of 272.21 g/mol. IUPAC name: 8,11-dihydroxy-[1,3]dioxolo[4,5-b]xanthen-10-one. InChIKey: BMRWSZGEVSNEOM-UHFFFAOYSA-N.
| Molecular formula | C14H8O6 |
|---|---|
| Molecular weight | 272.21 g/mol |
| IUPAC name | 8,11-dihydroxy-[1,3]dioxolo[4,5-b]xanthen-10-one |
| InChIKey | BMRWSZGEVSNEOM-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=C3C(=C2)OC4=C(C3=O)C=C(C=C4)O)O |
Computed by PubChem (NCBI)