CAS 183235-15-6 is the registry number for Lomefloxacin Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
1-ethyl-6,8-difluoro-7-(3-methylpiperazin-1-yl)quinolin-4-one (CAS 183235-15-6) is a chemical compound with the molecular formula C16H19F2N3O and a molecular weight of 307.34 g/mol. IUPAC name: 1-ethyl-6,8-difluoro-7-(3-methylpiperazin-1-yl)quinolin-4-one. InChIKey: JBKJMRNKAYHBPV-UHFFFAOYSA-N.
| Molecular formula | C16H19F2N3O |
|---|---|
| Molecular weight | 307.34 g/mol |
| IUPAC name | 1-ethyl-6,8-difluoro-7-(3-methylpiperazin-1-yl)quinolin-4-one |
| InChIKey | JBKJMRNKAYHBPV-UHFFFAOYSA-N |
| SMILES | CCN1C=CC(=O)C2=CC(=C(C(=C21)F)N3CCNC(C3)C)F |
Computed by PubChem (NCBI)