CAS 183266-61-7 appears in our catalog under these names: (Trifluoroacetyl)benzotriazole, 95%, 1–(1H–Benzo(d)(1,2,3)triazol–1–yl)–2,2,2–trifluoroethanone, (Trifluoroacetyl)benzotriazole (mixture of 1H- and 2H- isomers), >98.0%(HPLC), 1-(1H-Benzo[d][1,2,3]triazol-1-yl)-2,2,2-trifluoroethanone, 98%+(LC-MS),RG, 98%+(LC-MS),RG. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 25g, 200mg.
1-(benzotriazol-1-yl)-2,2,2-trifluoroethanone (CAS 183266-61-7) is a chemical compound with the molecular formula C8H4F3N3O and a molecular weight of 215.13 g/mol. IUPAC name: 1-(benzotriazol-1-yl)-2,2,2-trifluoroethanone. InChIKey: GVQIQOIKWUOEJP-UHFFFAOYSA-N.
| Molecular formula | C8H4F3N3O |
|---|---|
| Molecular weight | 215.13 g/mol |
| IUPAC name | 1-(benzotriazol-1-yl)-2,2,2-trifluoroethanone |
| InChIKey | GVQIQOIKWUOEJP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=NN2C(=O)C(F)(F)F |
Computed by PubChem (NCBI)