CAS 183274-54-6 is the registry number for 5-Bromo-4-chloro-2-(methylthio)-7H-pyrrolo(2,3-d)pyrimidine, 95+%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
5-bromo-4-chloro-2-methylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine (CAS 183274-54-6) is a chemical compound with the molecular formula C7H5BrClN3S and a molecular weight of 278.56 g/mol. IUPAC name: 5-bromo-4-chloro-2-methylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine. InChIKey: ILLCBZWHQZHRBS-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClN3S |
|---|---|
| Molecular weight | 278.56 g/mol |
| IUPAC name | 5-bromo-4-chloro-2-methylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine |
| InChIKey | ILLCBZWHQZHRBS-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(C(=CN2)Br)C(=N1)Cl |
Computed by PubChem (NCBI)