Products 1832872-91-9
CAS 1832872-91-9 is the registry number for 2-Amino-N-(2-((4-chloro-2-methylphenyl)amino)-2-oxoethyl)acetamide hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-N-[2-(4-chloro-2-methylanilino)-2-oxoethyl]acetamide;hydrochloride (CAS 1832872-91-9) is a chemical compound with the molecular formula C11H15Cl2N3O2 and a molecular weight of 292.16 g/mol. IUPAC name: 2-amino-N-[2-(4-chloro-2-methylanilino)-2-oxoethyl]acetamide;hydrochloride. InChIKey: GIMYKXFGSMBYLX-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2N3O2 |
|---|---|
| Molecular weight | 292.16 g/mol |
| IUPAC name | 2-amino-N-[2-(4-chloro-2-methylanilino)-2-oxoethyl]acetamide;hydrochloride |
| InChIKey | GIMYKXFGSMBYLX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)NC(=O)CNC(=O)CN.Cl |
Computed by PubChem (NCBI)