CAS 1834149-70-0 is the registry number for 1-(3-Aminopiperidin-1-yl)-2-(3,5-dimethylisoxazol-4-yl)ethan-1-one hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-aminopiperidin-1-yl)-2-(3,5-dimethyl-1,2-oxazol-4-yl)ethanone;hydrochloride (CAS 1834149-70-0) is a chemical compound with the molecular formula C12H20ClN3O2 and a molecular weight of 273.76 g/mol. IUPAC name: 1-(3-aminopiperidin-1-yl)-2-(3,5-dimethyl-1,2-oxazol-4-yl)ethanone;hydrochloride. InChIKey: YGTRWYHVUOODGD-UHFFFAOYSA-N.
| Molecular formula | C12H20ClN3O2 |
|---|---|
| Molecular weight | 273.76 g/mol |
| IUPAC name | 1-(3-aminopiperidin-1-yl)-2-(3,5-dimethyl-1,2-oxazol-4-yl)ethanone;hydrochloride |
| InChIKey | YGTRWYHVUOODGD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)CC(=O)N2CCCC(C2)N.Cl |
Computed by PubChem (NCBI)