CAS 183476-82-6 appears in our catalog under these names: Ascorbyl Tetraisopalmitate, Ascorbyl Tetraisopalmitate, >95% (HPLC), Tetrahexyldecyl ascorbate, Ascorbyl Tetraisopalmitate, Ascorbyl tetraisopalmitate, 95.00%. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Chemat. Available pack sizes: on request, 1g, 2,5g, 5g, 10g, 25g, 50g, 100g.
[(2S)-2-[(2R)-3,4-bis(2-hexyldecanoyloxy)-5-oxo-2H-furan-2-yl]-2-(2-hexyldecanoyloxy)ethyl] 2-hexyldecanoate (CAS 183476-82-6) is a chemical compound with the molecular formula C70H128O10 and a molecular weight of 1129.8 g/mol. IUPAC name: [(2S)-2-[(2R)-3,4-bis(2-hexyldecanoyloxy)-5-oxo-2H-furan-2-yl]-2-(2-hexyldecanoyloxy)ethyl] 2-hexyldecanoate. InChIKey: OEWBEINAQKIQLZ-CMRBMDBWSA-N.
| Molecular formula | C70H128O10 |
|---|---|
| Molecular weight | 1129.8 g/mol |
| IUPAC name | [(2S)-2-[(2R)-3,4-bis(2-hexyldecanoyloxy)-5-oxo-2H-furan-2-yl]-2-(2-hexyldecanoyloxy)ethyl] 2-hexyldecanoate |
| InChIKey | OEWBEINAQKIQLZ-CMRBMDBWSA-N |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OC[C@@H]([C@@H]1C(=C(C(=O)O1)OC(=O)C(CCCCCC)CCCCCCCC)OC(=O)C(CCCCCC)CCCCCCCC)OC(=O)C(CCCCCC)CCCCCCCC |
Computed by PubChem (NCBI)