CAS 183498-47-7 appears in our catalog under these names: Ac-His(1-Trt)-OH, 96%, Ac–His(1–Trt)–OH, Ac-His(1-Trt)-OH, 96%, 96%, Ac-His(Trt)-OH, 96%. Offered by: Combi-blocks, GLPBio, Chemat, Ambeed. Available pack sizes: 1g, 10g, 25g, 5g.
(2S)-2-acetamido-3-(1-tritylimidazol-4-yl)propanoic acid (CAS 183498-47-7) is a chemical compound with the molecular formula C27H25N3O3 and a molecular weight of 439.5 g/mol. IUPAC name: (2S)-2-acetamido-3-(1-tritylimidazol-4-yl)propanoic acid. InChIKey: MFOVFDBMJIPSLM-VWLOTQADSA-N.
| Molecular formula | C27H25N3O3 |
|---|---|
| Molecular weight | 439.5 g/mol |
| IUPAC name | (2S)-2-acetamido-3-(1-tritylimidazol-4-yl)propanoic acid |
| InChIKey | MFOVFDBMJIPSLM-VWLOTQADSA-N |
| SMILES | CC(=O)N[C@@H](CC1=CN(C=N1)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)C(=O)O |
Computed by PubChem (NCBI)