CAS 183547-74-2 is the registry number for 1,1,1,2,2,3,3,4,4-Nonafluoro-7-Iodoheptane. Offered by: Biosynth. Available pack sizes: 0,5g, 1g, 2g, 5g.
1,1,1,2,2,3,3,4,4-nonafluoro-7-iodoheptane (CAS 183547-74-2) is a chemical compound with the molecular formula C7H6F9I and a molecular weight of 388.01 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4-nonafluoro-7-iodoheptane. InChIKey: BPQUIZZKLVTZOY-UHFFFAOYSA-N.
| Molecular formula | C7H6F9I |
|---|---|
| Molecular weight | 388.01 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4-nonafluoro-7-iodoheptane |
| InChIKey | BPQUIZZKLVTZOY-UHFFFAOYSA-N |
| SMILES | C(CC(C(C(C(F)(F)F)(F)F)(F)F)(F)F)CI |
Computed by PubChem (NCBI)