Products 1835647-08-9
CAS 1835647-08-9 is the registry number for PXT-012253. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(4-chloro-3-methylsulfanylphenyl)pyridine-2-carboxamide (CAS 1835647-08-9) is a chemical compound with the molecular formula C13H11ClN2OS and a molecular weight of 278.76 g/mol. IUPAC name: N-(4-chloro-3-methylsulfanylphenyl)pyridine-2-carboxamide. InChIKey: BWRWLAWESQPUSB-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2OS |
|---|---|
| Molecular weight | 278.76 g/mol |
| IUPAC name | N-(4-chloro-3-methylsulfanylphenyl)pyridine-2-carboxamide |
| InChIKey | BWRWLAWESQPUSB-UHFFFAOYSA-N |
| SMILES | CSC1=C(C=CC(=C1)NC(=O)C2=CC=CC=N2)Cl |
Computed by PubChem (NCBI)