Products 1835726-73-2
CAS 1835726-73-2 is the registry number for 1-Bromo-3-(bromodifluoromethyl)benzene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-bromo-3-[bromo(difluoro)methyl]benzene (CAS 1835726-73-2) is a chemical compound with the molecular formula C7H4Br2F2 and a molecular weight of 285.91 g/mol. IUPAC name: 1-bromo-3-[bromo(difluoro)methyl]benzene. InChIKey: ZJAYPOHWQJVALC-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2F2 |
|---|---|
| Molecular weight | 285.91 g/mol |
| IUPAC name | 1-bromo-3-[bromo(difluoro)methyl]benzene |
| InChIKey | ZJAYPOHWQJVALC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(F)(F)Br |
Computed by PubChem (NCBI)