CAS 1835759-75-5 appears in our catalog under these names: T-Butoxycarbonyl-peg4-nhs ester, 95%, Boc-PEG4-C2-NHS ester, Boc–PEG4–C2–NHS ester, OtBu-PEG4-SPA, Boc-PEG4-C2-NHS ester 97%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 2mg, 500mg, 50mg, 25mg, 5g.
Tert-butyl 3-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1835759-75-5) is a chemical compound with the molecular formula C20H33NO10 and a molecular weight of 447.5 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: QYNINGPFVBXEGJ-UHFFFAOYSA-N.
| Molecular formula | C20H33NO10 |
|---|---|
| Molecular weight | 447.5 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | QYNINGPFVBXEGJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)