CAS 1835759-85-7 appears in our catalog under these names: Acid-peg4-t-butyl ester, 95%, Di-tert-butyl 4,7,10,13-tetraoxahexadecane-1,16-dioate, 95%, Acid-PEG4-C2-Boc, Acid–PEG4–C2–Boc, Acid-PEG4-t-butyl ester. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5mg, 10mg, 25mg, 50mg, 500mg.
3-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1835759-85-7) is a chemical compound with the molecular formula C16H30O8 and a molecular weight of 350.40 g/mol. IUPAC name: 3-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: LXMHKDZTUDTSCT-UHFFFAOYSA-N.
| Molecular formula | C16H30O8 |
|---|---|
| Molecular weight | 350.40 g/mol |
| IUPAC name | 3-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | LXMHKDZTUDTSCT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)