CAS 1836075-97-8 is the registry number for (3-Aminopiperidin-1-yl)(4-methylthiazol-5-yl)methanone hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3-aminopiperidin-1-yl)-(4-methyl-1,3-thiazol-5-yl)methanone;hydrochloride (CAS 1836075-97-8) is a chemical compound with the molecular formula C10H16ClN3OS and a molecular weight of 261.77 g/mol. IUPAC name: (3-aminopiperidin-1-yl)-(4-methyl-1,3-thiazol-5-yl)methanone;hydrochloride. InChIKey: ZJAAQQKFGGMZCA-UHFFFAOYSA-N.
| Molecular formula | C10H16ClN3OS |
|---|---|
| Molecular weight | 261.77 g/mol |
| IUPAC name | (3-aminopiperidin-1-yl)-(4-methyl-1,3-thiazol-5-yl)methanone;hydrochloride |
| InChIKey | ZJAAQQKFGGMZCA-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=N1)C(=O)N2CCCC(C2)N.Cl |
Computed by PubChem (NCBI)