Products 183626-28-0
CAS 183626-28-0 appears in our catalog under these names: Cleroindicin C, Cleroindicin C. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg, 50mg, Get quote.
(3aR,7aS)-3a-hydroxy-2,3,4,5,7,7a-hexahydro-1-benzofuran-6-one (CAS 183626-28-0) is a chemical compound with the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. IUPAC name: (3aR,7aS)-3a-hydroxy-2,3,4,5,7,7a-hexahydro-1-benzofuran-6-one. InChIKey: ZCBQZDMJIVJQLX-JGVFFNPUSA-N.
| Molecular formula | C8H12O3 |
|---|---|
| Molecular weight | 156.18 g/mol |
| IUPAC name | (3aR,7aS)-3a-hydroxy-2,3,4,5,7,7a-hexahydro-1-benzofuran-6-one |
| InChIKey | ZCBQZDMJIVJQLX-JGVFFNPUSA-N |
| SMILES | C1C[C@]2(CCO[C@H]2CC1=O)O |
Computed by PubChem (NCBI)