CAS 183721-13-3 is the registry number for MRS1177. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[9-chloro-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]quinazolin-5-yl]benzamide (CAS 183721-13-3) is a chemical compound with the molecular formula C20H12ClN5O2 and a molecular weight of 389.8 g/mol. IUPAC name: N-[9-chloro-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]quinazolin-5-yl]benzamide. InChIKey: XIEBLXLGWFCYEP-UHFFFAOYSA-N.
| Molecular formula | C20H12ClN5O2 |
|---|---|
| Molecular weight | 389.8 g/mol |
| IUPAC name | N-[9-chloro-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]quinazolin-5-yl]benzamide |
| InChIKey | XIEBLXLGWFCYEP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=NC3=C(C=C(C=C3)Cl)C4=NC(=NN42)C5=CC=CO5 |
Computed by PubChem (NCBI)