CAS 1837320-83-8 is the registry number for (3-Aminopyrrolidin-1-yl)(2,3,4-trifluorophenyl)methanone hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3-aminopyrrolidin-1-yl)-(2,3,4-trifluorophenyl)methanone;hydrochloride (CAS 1837320-83-8) is a chemical compound with the molecular formula C11H12ClF3N2O and a molecular weight of 280.67 g/mol. IUPAC name: (3-aminopyrrolidin-1-yl)-(2,3,4-trifluorophenyl)methanone;hydrochloride. InChIKey: IZTFXAFHRSRAGQ-UHFFFAOYSA-N.
| Molecular formula | C11H12ClF3N2O |
|---|---|
| Molecular weight | 280.67 g/mol |
| IUPAC name | (3-aminopyrrolidin-1-yl)-(2,3,4-trifluorophenyl)methanone;hydrochloride |
| InChIKey | IZTFXAFHRSRAGQ-UHFFFAOYSA-N |
| SMILES | C1CN(CC1N)C(=O)C2=C(C(=C(C=C2)F)F)F.Cl |
Computed by PubChem (NCBI)