Products 1837810-39-5
CAS 1837810-39-5 is the registry number for N-(4,5-Dimethylthiazol-2-yl)-2-(phenylamino)acetamide hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-anilino-N-(4,5-dimethyl-1,3-thiazol-2-yl)acetamide;hydrochloride (CAS 1837810-39-5) is a chemical compound with the molecular formula C13H16ClN3OS and a molecular weight of 297.80 g/mol. IUPAC name: 2-anilino-N-(4,5-dimethyl-1,3-thiazol-2-yl)acetamide;hydrochloride. InChIKey: SXHTWPVCMMEODP-UHFFFAOYSA-N.
| Molecular formula | C13H16ClN3OS |
|---|---|
| Molecular weight | 297.80 g/mol |
| IUPAC name | 2-anilino-N-(4,5-dimethyl-1,3-thiazol-2-yl)acetamide;hydrochloride |
| InChIKey | SXHTWPVCMMEODP-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)NC(=O)CNC2=CC=CC=C2)C.Cl |
Computed by PubChem (NCBI)