CAS 183871-34-3 appears in our catalog under these names: Posaconazole Impurity 58, Posaconazole Impurity 128, Posaconazole Impurity 52, 2-((1S,2S)-1-Ethyl-2-(phenylmethoxy)propyl)hydrazine. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
[(2S,3S)-2-phenylmethoxypentan-3-yl]hydrazine (CAS 183871-34-3) is a chemical compound with the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. IUPAC name: [(2S,3S)-2-phenylmethoxypentan-3-yl]hydrazine. InChIKey: FSVROTJLGHZEMC-JQWIXIFHSA-N.
| Molecular formula | C12H20N2O |
|---|---|
| Molecular weight | 208.30 g/mol |
| IUPAC name | [(2S,3S)-2-phenylmethoxypentan-3-yl]hydrazine |
| InChIKey | FSVROTJLGHZEMC-JQWIXIFHSA-N |
| SMILES | CC[C@@H]([C@H](C)OCC1=CC=CC=C1)NN |
Computed by PubChem (NCBI)